C18H20FN5O3 — CID 118132687
[2-fluoro-3-(6-morpholin-4-yl-3-pyridinyl)phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 118132687) has the molecular formula C18H20FN5O3 and a molecular weight of 373.39 g/mol. Its IUPAC name is [2-fluoro-3-(6-morpholin-4-yl-3-pyridinyl)phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-(6-morpholin-4-yl-3-pyridinyl)phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 118132687 |
| Molecular Formula | C18H20FN5O3 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [2-fluoro-3-(6-morpholin-4-yl-3-pyridinyl)phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1cccc(-c2ccc(N3CCOCC3)nc2)c1F |
| InChI | InChI=1S/C18H20FN5O3/c19-16-13(11-27-18(25)23-17(20)21)2-1-3-14(16)12-4-5-15(22-10-12)24-6-8-26-9-7-24/h1-5,10H,6-9,11H2,(H4,20,21,23,25) |
| InChIKey | OIGRHHDOIOAYFJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|