C25H35N5O4SSi — CID 11813430
N-[9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 11813430) has the molecular formula C25H35N5O4SSi and a molecular weight of 529.74 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 11813430 |
| Molecular Formula | C25H35N5O4SSi |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CSCO[C@H]1C[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H35N5O4SSi/c1-25(2,3)36(5,6)33-13-19-18(32-16-35-4)12-20(34-19)30-15-28-21-22(26-14-27-23(21)30)29-24(31)17-10-8-7-9-11-17/h7-11,14-15,18-20H,12-13,16H2,1-6H3,(H,26,27,29,31)/t18-,19+,20+/m0/s1 |
| InChIKey | CMWPOTWGKCOYRU-XUVXKRRUSA-N |
| XLogP | 5.09 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|