C22H45N2O3+ — CID 118134697
3-[(3-carboxy-2,5-dimethyltridecanoyl)amino]propyl-trimethylazanium (PubChem CID 118134697) has the molecular formula C22H45N2O3+ and a molecular weight of 385.61 g/mol. Its IUPAC name is 3-[(3-carboxy-2,5-dimethyltridecanoyl)amino]propyl-trimethylazanium.
| Compound Name | 3-[(3-carboxy-2,5-dimethyltridecanoyl)amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 118134697 |
| Molecular Formula | C22H45N2O3+ |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 385.34 |
| IUPAC Name | 3-[(3-carboxy-2,5-dimethyltridecanoyl)amino]propyl-trimethylazanium |
| SMILES | CCCCCCCCC(C)CC(C(=O)O)C(C)C(=O)NCCC[N+](C)(C)C |
| InChI | InChI=1S/C22H44N2O3/c1-7-8-9-10-11-12-14-18(2)17-20(22(26)27)19(3)21(25)23-15-13-16-24(4,5)6/h18-20H,7-17H2,1-6H3,(H-,23,25,26,27)/p+1 |
| InChIKey | HVNBFTMOOKZILH-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|