C23H20F2N6O5S — CID 118137170
N-[2,4-difluoro-3-[[6-[6-(hydroxymethyl)-5-nitro-3-pyridinyl]quinazolin-4-yl]amino]phenyl]propane-1-sulfonamide (PubChem CID 118137170) has the molecular formula C23H20F2N6O5S and a molecular weight of 530.51 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[[6-[6-(hydroxymethyl)-5-nitro-3-pyridinyl]quinazolin-4-yl]amino]phenyl]propane-1-sulfonamide.
| Compound Name | N-[2,4-difluoro-3-[[6-[6-(hydroxymethyl)-5-nitro-3-pyridinyl]quinazolin-4-yl]amino]phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 118137170 |
| Molecular Formula | C23H20F2N6O5S |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | N-[2,4-difluoro-3-[[6-[6-(hydroxymethyl)-5-nitro-3-pyridinyl]quinazolin-4-yl]amino]phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(Nc2ncnc3ccc(-c4cnc(CO)c([N+](=O)[O-])c4)cc23)c1F |
| InChI | InChI=1S/C23H20F2N6O5S/c1-2-7-37(35,36)30-18-6-4-16(24)22(21(18)25)29-23-15-8-13(3-5-17(15)27-12-28-23)14-9-20(31(33)34)19(11-32)26-10-14/h3-6,8-10,12,30,32H,2,7,11H2,1H3,(H,27,28,29) |
| InChIKey | PIYHTTSEJMILTP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 160.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|