C25H21F2N5O3S — CID 118138883
(3R)-3-[2-(difluoromethoxy)phenyl]-11-[2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one (PubChem CID 118138883) has the molecular formula C25H21F2N5O3S and a molecular weight of 509.54 g/mol. Its IUPAC name is (3R)-3-[2-(difluoromethoxy)phenyl]-11-[2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one.
| Compound Name | (3R)-3-[2-(difluoromethoxy)phenyl]-11-[2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one |
|---|---|
| PubChem CID | 118138883 |
| Molecular Formula | C25H21F2N5O3S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | (3R)-3-[2-(difluoromethoxy)phenyl]-11-[2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one |
| SMILES | O=C1C[C@H](c2ccccc2OC(F)F)c2c1nc1ccc(-c3cnc(N4CCS(=O)CC4)nc3)cn21 |
| InChI | InChI=1S/C25H21F2N5O3S/c26-24(27)35-20-4-2-1-3-17(20)18-11-19(33)22-23(18)32-14-15(5-6-21(32)30-22)16-12-28-25(29-13-16)31-7-9-36(34)10-8-31/h1-6,12-14,18,24H,7-11H2/t18-/m1/s1 |
| InChIKey | GGYPBJWJEONMBD-GOSISDBHSA-N |
| XLogP | 3.68 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |