C25H22F2N6O3 — CID 118153321
4-[5-[(3R,5R)-3-[2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]pyrimidin-2-yl]piperazin-2-one (PubChem CID 118153321) has the molecular formula C25H22F2N6O3 and a molecular weight of 492.49 g/mol. Its IUPAC name is 4-[5-[(3R,5R)-3-[2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]pyrimidin-2-yl]piperazin-2-one.
| Compound Name | 4-[5-[(3R,5R)-3-[2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]pyrimidin-2-yl]piperazin-2-one |
|---|---|
| PubChem CID | 118153321 |
| Molecular Formula | C25H22F2N6O3 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 4-[5-[(3R,5R)-3-[2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]pyrimidin-2-yl]piperazin-2-one |
| SMILES | O=C1CN(c2ncc(-c3ccc4nc5c(n4c3)[C@@H](c3ccccc3OC(F)F)C[C@H]5O)cn2)CCN1 |
| InChI | InChI=1S/C25H22F2N6O3/c26-24(27)36-19-4-2-1-3-16(19)17-9-18(34)22-23(17)33-12-14(5-6-20(33)31-22)15-10-29-25(30-11-15)32-8-7-28-21(35)13-32/h1-6,10-12,17-18,24,34H,7-9,13H2,(H,28,35)/t17-,18-/m1/s1 |
| InChIKey | DQUOOWHZKMJMIM-QZTJIDSGSA-N |
| XLogP | 2.90 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |