C24H19ClF2N2O4S — CID 118153638
(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol (PubChem CID 118153638) has the molecular formula C24H19ClF2N2O4S and a molecular weight of 504.94 g/mol. Its IUPAC name is (3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol.
| Compound Name | (3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol |
|---|---|
| PubChem CID | 118153638 |
| Molecular Formula | C24H19ClF2N2O4S |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | (3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3nc4c(n3c2)[C@@H](c2cc(Cl)ccc2OC(F)F)C[C@H]4O)cc1 |
| InChI | InChI=1S/C24H19ClF2N2O4S/c1-34(31,32)16-6-2-13(3-7-16)14-4-9-21-28-22-19(30)11-18(23(22)29(21)12-14)17-10-15(25)5-8-20(17)33-24(26)27/h2-10,12,18-19,24,30H,11H2,1H3/t18-,19-/m1/s1 |
| InChIKey | GSRJNXFPRKFEQK-RTBURBONSA-N |
| XLogP | 5.23 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |