C24H17F3N2O4S — CID 118153425
(3R)-3-[2-(difluoromethoxy)phenyl]-10-fluoro-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one (PubChem CID 118153425) has the molecular formula C24H17F3N2O4S and a molecular weight of 486.47 g/mol. Its IUPAC name is (3R)-3-[2-(difluoromethoxy)phenyl]-10-fluoro-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one.
| Compound Name | (3R)-3-[2-(difluoromethoxy)phenyl]-10-fluoro-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one |
|---|---|
| PubChem CID | 118153425 |
| Molecular Formula | C24H17F3N2O4S |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | (3R)-3-[2-(difluoromethoxy)phenyl]-10-fluoro-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one |
| SMILES | CS(=O)(=O)c1ccc(-c2cn3c4c(nc3cc2F)C(=O)C[C@@H]4c2ccccc2OC(F)F)cc1 |
| InChI | InChI=1S/C24H17F3N2O4S/c1-34(31,32)14-8-6-13(7-9-14)17-12-29-21(11-18(17)25)28-22-19(30)10-16(23(22)29)15-4-2-3-5-20(15)33-24(26)27/h2-9,11-12,16,24H,10H2,1H3/t16-/m1/s1 |
| InChIKey | NNCCPYQESPXGAS-MRXNPFEDSA-N |
| XLogP | 4.86 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |