C25H22F2N2O4S — CID 118153488
(3R)-3-[2-(difluoromethoxy)phenyl]-5-methyl-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol (PubChem CID 118153488) has the molecular formula C25H22F2N2O4S and a molecular weight of 484.52 g/mol. Its IUPAC name is (3R)-3-[2-(difluoromethoxy)phenyl]-5-methyl-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol.
| Compound Name | (3R)-3-[2-(difluoromethoxy)phenyl]-5-methyl-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol |
|---|---|
| PubChem CID | 118153488 |
| Molecular Formula | C25H22F2N2O4S |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (3R)-3-[2-(difluoromethoxy)phenyl]-5-methyl-11-(4-methylsulfonylphenyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol |
| SMILES | CC1(O)C[C@H](c2ccccc2OC(F)F)c2c1nc1ccc(-c3ccc(S(C)(=O)=O)cc3)cn21 |
| InChI | InChI=1S/C25H22F2N2O4S/c1-25(30)13-19(18-5-3-4-6-20(18)33-24(26)27)22-23(25)28-21-12-9-16(14-29(21)22)15-7-10-17(11-8-15)34(2,31)32/h3-12,14,19,24,30H,13H2,1-2H3/t19-,25?/m1/s1 |
| InChIKey | HPMHDKKJFJGFSG-OEPVSBQMSA-N |
| XLogP | 4.75 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |