C23H20F2N4O4S — CID 146047811
(3R,6S)-3-[2-(difluoromethoxy)phenyl]-12-(4-methylsulfonylphenyl)-1,4,8,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-6-ol (PubChem CID 146047811) has the molecular formula C23H20F2N4O4S and a molecular weight of 486.50 g/mol. Its IUPAC name is (3R,6S)-3-[2-(difluoromethoxy)phenyl]-12-(4-methylsulfonylphenyl)-1,4,8,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-6-ol.
| Compound Name | (3R,6S)-3-[2-(difluoromethoxy)phenyl]-12-(4-methylsulfonylphenyl)-1,4,8,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-6-ol |
|---|---|
| PubChem CID | 146047811 |
| Molecular Formula | C23H20F2N4O4S |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (3R,6S)-3-[2-(difluoromethoxy)phenyl]-12-(4-methylsulfonylphenyl)-1,4,8,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-6-ol |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3nc4c(n3n2)[C@@H](c2ccccc2OC(F)F)NC[C@@H]4O)cc1 |
| InChI | InChI=1S/C23H20F2N4O4S/c1-34(31,32)14-8-6-13(7-9-14)16-10-11-19-27-21-17(30)12-26-20(22(21)29(19)28-16)15-4-2-3-5-18(15)33-23(24)25/h2-11,17,20,23,26,30H,12H2,1H3/t17-,20+/m0/s1 |
| InChIKey | VRBXAJMGUYKMGP-FXAWDEMLSA-N |
| XLogP | 3.13 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |