C11H15ClN6 — CID 118139230
1-(6-chloro-7H-purin-8-yl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 118139230) has the molecular formula C11H15ClN6 and a molecular weight of 266.74 g/mol. Its IUPAC name is 1-(6-chloro-7H-purin-8-yl)-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(6-chloro-7H-purin-8-yl)-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 118139230 |
| Molecular Formula | C11H15ClN6 |
| Molecular Weight | 266.74 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 1-(6-chloro-7H-purin-8-yl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(c2nc3ncnc(Cl)c3[nH]2)C1 |
| InChI | InChI=1S/C11H15ClN6/c1-17(2)7-3-4-18(5-7)11-15-8-9(12)13-6-14-10(8)16-11/h6-7H,3-5H2,1-2H3,(H,13,14,15,16) |
| InChIKey | YLNOSGXDGMLHNC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.74 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |