C12H14ClN5O3 — CID 118139282
ethyl 4-(6-chloro-7H-purin-8-yl)morpholine-2-carboxylate (PubChem CID 118139282) has the molecular formula C12H14ClN5O3 and a molecular weight of 311.73 g/mol. Its IUPAC name is ethyl 4-(6-chloro-7H-purin-8-yl)morpholine-2-carboxylate.
| Compound Name | ethyl 4-(6-chloro-7H-purin-8-yl)morpholine-2-carboxylate |
|---|---|
| PubChem CID | 118139282 |
| Molecular Formula | C12H14ClN5O3 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | ethyl 4-(6-chloro-7H-purin-8-yl)morpholine-2-carboxylate |
| SMILES | CCOC(=O)C1CN(c2nc3ncnc(Cl)c3[nH]2)CCO1 |
| InChI | InChI=1S/C12H14ClN5O3/c1-2-20-11(19)7-5-18(3-4-21-7)12-16-8-9(13)14-6-15-10(8)17-12/h6-7H,2-5H2,1H3,(H,14,15,16,17) |
| InChIKey | GDYQOUIRCDSGDO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |