C17H19ClFN3O2 — CID 118139670
tert-butyl N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)-2-methylphenyl]methyl]carbamate (PubChem CID 118139670) has the molecular formula C17H19ClFN3O2 and a molecular weight of 351.81 g/mol. Its IUPAC name is tert-butyl N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)-2-methylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)-2-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 118139670 |
| Molecular Formula | C17H19ClFN3O2 |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | tert-butyl N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)-2-methylphenyl]methyl]carbamate |
| SMILES | Cc1cc(-c2nc(Cl)ncc2F)ccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H19ClFN3O2/c1-10-7-11(14-13(19)9-20-15(18)22-14)5-6-12(10)8-21-16(23)24-17(2,3)4/h5-7,9H,8H2,1-4H3,(H,21,23) |
| InChIKey | AQUSAADLLGFATG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |