C20H28N2O2 — CID 118143419
propan-2-yl 4-(2-adamantylamino)-3-aminobenzoate (PubChem CID 118143419) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is propan-2-yl 4-(2-adamantylamino)-3-aminobenzoate.
| Compound Name | propan-2-yl 4-(2-adamantylamino)-3-aminobenzoate |
|---|---|
| PubChem CID | 118143419 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | propan-2-yl 4-(2-adamantylamino)-3-aminobenzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC2C3CC4CC(C3)CC2C4)c(N)c1 |
| InChI | InChI=1S/C20H28N2O2/c1-11(2)24-20(23)14-3-4-18(17(21)10-14)22-19-15-6-12-5-13(8-15)9-16(19)7-12/h3-4,10-13,15-16,19,22H,5-9,21H2,1-2H3 |
| InChIKey | AMZVQGUGKJSJCE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|