C21H21N9O — CID 118146452
2-[6-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-12-yl]butanenitrile (PubChem CID 118146452) has the molecular formula C21H21N9O and a molecular weight of 415.46 g/mol. Its IUPAC name is 2-[6-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-12-yl]butanenitrile.
| Compound Name | 2-[6-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-12-yl]butanenitrile |
|---|---|
| PubChem CID | 118146452 |
| Molecular Formula | C21H21N9O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[6-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-12-yl]butanenitrile |
| SMILES | CCC(C#N)C1CCOc2cc(-c3ccnc(Nc4ccnn4C)n3)cc3nnc1n23 |
| InChI | InChI=1S/C21H21N9O/c1-3-13(12-22)15-6-9-31-19-11-14(10-18-27-28-20(15)30(18)19)16-4-7-23-21(25-16)26-17-5-8-24-29(17)2/h4-5,7-8,10-11,13,15H,3,6,9H2,1-2H3,(H,23,25,26) |
| InChIKey | CYZNMCWEXWUOBS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |