C17H17N9O — CID 134171716
6-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-12-amine (PubChem CID 134171716) has the molecular formula C17H17N9O and a molecular weight of 363.39 g/mol. Its IUPAC name is 6-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-12-amine.
| Compound Name | 6-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-12-amine |
|---|---|
| PubChem CID | 134171716 |
| Molecular Formula | C17H17N9O |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-12-amine |
| SMILES | Cn1nccc1Nc1nccc(-c2cc3n4c(nnc4c2)C(N)CCO3)n1 |
| InChI | InChI=1S/C17H17N9O/c1-25-13(3-6-20-25)22-17-19-5-2-12(21-17)10-8-14-23-24-16-11(18)4-7-27-15(9-10)26(14)16/h2-3,5-6,8-9,11H,4,7,18H2,1H3,(H,19,21,22) |
| InChIKey | FHCFTHRBVCBSKQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |