C42H46O6S2 — CID 118150998
9,23-bis(octylsulfonyl)-14,28-dioxaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaene (PubChem CID 118150998) has the molecular formula C42H46O6S2 and a molecular weight of 710.96 g/mol. Its IUPAC name is 9,23-bis(octylsulfonyl)-14,28-dioxaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaene.
| Compound Name | 9,23-bis(octylsulfonyl)-14,28-dioxaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaene |
|---|---|
| PubChem CID | 118150998 |
| Molecular Formula | C42H46O6S2 |
| Molecular Weight | 710.96 g/mol |
| Exact Mass | 710.27 |
| IUPAC Name | 9,23-bis(octylsulfonyl)-14,28-dioxaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaene |
| SMILES | CCCCCCCCS(=O)(=O)c1ccc2cc3c(cc2c1)oc1cc2c(cc13)oc1cc3cc(S(=O)(=O)CCCCCCCC)ccc3cc12 |
| InChI | InChI=1S/C42H46O6S2/c1-3-5-7-9-11-13-19-49(43,44)33-17-15-29-23-35-37-27-42-38(28-41(37)47-39(35)25-31(29)21-33)36-24-30-16-18-34(22-32(30)26-40(36)48-42)50(45,46)20-14-12-10-8-6-4-2/h15-18,21-28H,3-14,19-20H2,1-2H3 |
| InChIKey | XYBAUUNQTBWSRO-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.96 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|