C17H14BrF2N3O — CID 118152477
(3R)-12-bromo-3-[2-(difluoromethoxy)phenyl]-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 118152477) has the molecular formula C17H14BrF2N3O and a molecular weight of 394.22 g/mol. Its IUPAC name is (3R)-12-bromo-3-[2-(difluoromethoxy)phenyl]-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | (3R)-12-bromo-3-[2-(difluoromethoxy)phenyl]-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 118152477 |
| Molecular Formula | C17H14BrF2N3O |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | (3R)-12-bromo-3-[2-(difluoromethoxy)phenyl]-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | FC(F)Oc1ccccc1[C@H]1NCCc2nc3ccc(Br)cn3c21 |
| InChI | InChI=1S/C17H14BrF2N3O/c18-10-5-6-14-22-12-7-8-21-15(16(12)23(14)9-10)11-3-1-2-4-13(11)24-17(19)20/h1-6,9,15,17,21H,7-8H2/t15-/m1/s1 |
| InChIKey | JBBPVHWDZIJUJU-OAHLLOKOSA-N |
| XLogP | 3.93 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |