C13H14BrN3 — CID 115403554
5-bromo-15-methyl-3,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),4,6,8-tetraene (PubChem CID 115403554) has the molecular formula C13H14BrN3 and a molecular weight of 292.18 g/mol. Its IUPAC name is 5-bromo-15-methyl-3,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),4,6,8-tetraene.
| Compound Name | 5-bromo-15-methyl-3,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 115403554 |
| Molecular Formula | C13H14BrN3 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 5-bromo-15-methyl-3,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),4,6,8-tetraene |
| SMILES | CN1C2CCC1c1c(nc3ccc(Br)cn13)C2 |
| InChI | InChI=1S/C13H14BrN3/c1-16-9-3-4-11(16)13-10(6-9)15-12-5-2-8(14)7-17(12)13/h2,5,7,9,11H,3-4,6H2,1H3 |
| InChIKey | HBTAFXZFACOGRI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |