C18H17IN2O4S — CID 118157157
(2R)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxy-3-(2-methoxyphenyl)propanoic acid (PubChem CID 118157157) has the molecular formula C18H17IN2O4S and a molecular weight of 484.32 g/mol. Its IUPAC name is (2R)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxy-3-(2-methoxyphenyl)propanoic acid.
| Compound Name | (2R)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxy-3-(2-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 118157157 |
| Molecular Formula | C18H17IN2O4S |
| Molecular Weight | 484.32 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | (2R)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxy-3-(2-methoxyphenyl)propanoic acid |
| SMILES | CCc1sc2ncnc(O[C@H](Cc3ccccc3OC)C(=O)O)c2c1I |
| InChI | InChI=1S/C18H17IN2O4S/c1-3-13-15(19)14-16(20-9-21-17(14)26-13)25-12(18(22)23)8-10-6-4-5-7-11(10)24-2/h4-7,9,12H,3,8H2,1-2H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | HIYXWYXHCUGQFA-GFCCVEGCSA-N |
| XLogP | 3.94 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|