C20H21IN2O4S — CID 131742843
ethyl (2S)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxy-3-(2-methoxyphenyl)propanoate (PubChem CID 131742843) has the molecular formula C20H21IN2O4S and a molecular weight of 512.37 g/mol. Its IUPAC name is ethyl (2S)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxy-3-(2-methoxyphenyl)propanoate.
| Compound Name | ethyl (2S)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxy-3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 131742843 |
| Molecular Formula | C20H21IN2O4S |
| Molecular Weight | 512.37 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | ethyl (2S)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxy-3-(2-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1OC)Oc1ncnc2sc(CC)c(I)c12 |
| InChI | InChI=1S/C20H21IN2O4S/c1-4-15-17(21)16-18(22-11-23-19(16)28-15)27-14(20(24)26-5-2)10-12-8-6-7-9-13(12)25-3/h6-9,11,14H,4-5,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | GVOFXKVWEVWTGS-AWEZNQCLSA-N |
| XLogP | 4.42 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|