C18H15IN2O5S — CID 118157461
(2S)-3-(1,3-benzodioxol-4-yl)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxypropanoic acid (PubChem CID 118157461) has the molecular formula C18H15IN2O5S and a molecular weight of 498.30 g/mol. Its IUPAC name is (2S)-3-(1,3-benzodioxol-4-yl)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxypropanoic acid.
| Compound Name | (2S)-3-(1,3-benzodioxol-4-yl)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxypropanoic acid |
|---|---|
| PubChem CID | 118157461 |
| Molecular Formula | C18H15IN2O5S |
| Molecular Weight | 498.30 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | (2S)-3-(1,3-benzodioxol-4-yl)-2-(6-ethyl-5-iodothieno[2,3-d]pyrimidin-4-yl)oxypropanoic acid |
| SMILES | CCc1sc2ncnc(O[C@@H](Cc3cccc4c3OCO4)C(=O)O)c2c1I |
| InChI | InChI=1S/C18H15IN2O5S/c1-2-12-14(19)13-16(20-7-21-17(13)27-12)26-11(18(22)23)6-9-4-3-5-10-15(9)25-8-24-10/h3-5,7,11H,2,6,8H2,1H3,(H,22,23)/t11-/m0/s1 |
| InChIKey | WFEUFGUEPULILU-NSHDSACASA-N |
| XLogP | 3.66 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|