C22H25F5NO5S+ — CID 118161009
benzyl(trimethyl)azanium;2-(4-ethenylbenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 118161009) has the molecular formula C22H25F5NO5S+ and a molecular weight of 510.50 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;2-(4-ethenylbenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | benzyl(trimethyl)azanium;2-(4-ethenylbenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118161009 |
| Molecular Formula | C22H25F5NO5S+ |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | benzyl(trimethyl)azanium;2-(4-ethenylbenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | C=Cc1ccc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)cc1.C[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C12H9F5O5S.C10H16N/c1-2-7-3-5-8(6-4-7)9(18)22-10(11(13,14)15)12(16,17)23(19,20)21;1-11(2,3)9-10-7-5-4-6-8-10/h2-6,10H,1H2,(H,19,20,21);4-8H,9H2,1-3H3/q;+1 |
| InChIKey | SFXMCZMUAXQGCY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|