C24H44O5 — CID 118162576
hexane-1,1-diol;2-methylprop-2-enoyl 11-methyl-2-methylidenedodecanoate (PubChem CID 118162576) has the molecular formula C24H44O5 and a molecular weight of 412.61 g/mol. Its IUPAC name is hexane-1,1-diol;2-methylprop-2-enoyl 11-methyl-2-methylidenedodecanoate.
| Compound Name | hexane-1,1-diol;2-methylprop-2-enoyl 11-methyl-2-methylidenedodecanoate |
|---|---|
| PubChem CID | 118162576 |
| Molecular Formula | C24H44O5 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | hexane-1,1-diol;2-methylprop-2-enoyl 11-methyl-2-methylidenedodecanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(=C)CCCCCCCCC(C)C.CCCCCC(O)O |
| InChI | InChI=1S/C18H30O3.C6H14O2/c1-14(2)12-10-8-6-7-9-11-13-16(5)18(20)21-17(19)15(3)4;1-2-3-4-5-6(7)8/h14H,3,5-13H2,1-2,4H3;6-8H,2-5H2,1H3 |
| InChIKey | FPSOPJJSSMCRKT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|