C27H26FN9O2 — CID 118162654
N-[4-fluoro-3-[6-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 118162654) has the molecular formula C27H26FN9O2 and a molecular weight of 527.56 g/mol. Its IUPAC name is N-[4-fluoro-3-[6-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[4-fluoro-3-[6-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 118162654 |
| Molecular Formula | C27H26FN9O2 |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | N-[4-fluoro-3-[6-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(F)c(-c3nc4ncc(-c5ccc(N6CCN(C)CC6)nc5)cn4n3)c2)o1 |
| InChI | InChI=1S/C27H26FN9O2/c1-16-24(39-17(2)31-16)26(38)32-20-5-6-22(28)21(12-20)25-33-27-30-14-19(15-37(27)34-25)18-4-7-23(29-13-18)36-10-8-35(3)9-11-36/h4-7,12-15H,8-11H2,1-3H3,(H,32,38) |
| InChIKey | JPWJJCCKAOODGA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |