C24H21FN6O5 — CID 86296181
N-[4-fluoro-3-[6-[(6-methyl-2,3-dihydro-1,4-dioxine-5-carbonyl)amino]imidazo[1,2-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 86296181) has the molecular formula C24H21FN6O5 and a molecular weight of 492.47 g/mol. Its IUPAC name is N-[4-fluoro-3-[6-[(6-methyl-2,3-dihydro-1,4-dioxine-5-carbonyl)amino]imidazo[1,2-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[4-fluoro-3-[6-[(6-methyl-2,3-dihydro-1,4-dioxine-5-carbonyl)amino]imidazo[1,2-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 86296181 |
| Molecular Formula | C24H21FN6O5 |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-[4-fluoro-3-[6-[(6-methyl-2,3-dihydro-1,4-dioxine-5-carbonyl)amino]imidazo[1,2-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cnc3nc(-c4cc(NC(=O)c5oc(C)nc5C)ccc4F)cn3c2)OCCO1 |
| InChI | InChI=1S/C24H21FN6O5/c1-12-20(36-14(3)27-12)22(32)28-15-4-5-18(25)17(8-15)19-11-31-10-16(9-26-24(31)30-19)29-23(33)21-13(2)34-6-7-35-21/h4-5,8-11H,6-7H2,1-3H3,(H,28,32)(H,29,33) |
| InChIKey | BVOSHUVHILYEEF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |