C18H23F3N2O4 — CID 118163503
methyl 3-[(3R)-7-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydroquinolin-3-yl]propanoate (PubChem CID 118163503) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is methyl 3-[(3R)-7-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydroquinolin-3-yl]propanoate.
| Compound Name | methyl 3-[(3R)-7-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydroquinolin-3-yl]propanoate |
|---|---|
| PubChem CID | 118163503 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl 3-[(3R)-7-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydroquinolin-3-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CNc2cc(NC(=O)OC(C)(C)C(F)(F)F)ccc2C1 |
| InChI | InChI=1S/C18H23F3N2O4/c1-17(2,18(19,20)21)27-16(25)23-13-6-5-12-8-11(4-7-15(24)26-3)10-22-14(12)9-13/h5-6,9,11,22H,4,7-8,10H2,1-3H3,(H,23,25)/t11-/m1/s1 |
| InChIKey | RSJBHKAFZJCUPH-LLVKDONJSA-N |
| XLogP | 4.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |