C17H21F3N2O4 — CID 118163414
3-[7-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydroquinolin-3-yl]propanoic acid (PubChem CID 118163414) has the molecular formula C17H21F3N2O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is 3-[7-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydroquinolin-3-yl]propanoic acid.
| Compound Name | 3-[7-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydroquinolin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 118163414 |
| Molecular Formula | C17H21F3N2O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-[7-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydroquinolin-3-yl]propanoic acid |
| SMILES | CC(C)(OC(=O)Nc1ccc2c(c1)NCC(CCC(=O)O)C2)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2O4/c1-16(2,17(18,19)20)26-15(25)22-12-5-4-11-7-10(3-6-14(23)24)9-21-13(11)8-12/h4-5,8,10,21H,3,6-7,9H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | NIJRZPZAFIETCE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |