C18H21Cl2F3N6O2 — CID 118166329
(2S)-1-[4-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-2-ol (PubChem CID 118166329) has the molecular formula C18H21Cl2F3N6O2 and a molecular weight of 481.31 g/mol. Its IUPAC name is (2S)-1-[4-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-2-ol.
| Compound Name | (2S)-1-[4-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-2-ol |
|---|---|
| PubChem CID | 118166329 |
| Molecular Formula | C18H21Cl2F3N6O2 |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | (2S)-1-[4-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-2-ol |
| SMILES | Nc1nc(N2CCN(C[C@H](O)COCC(F)(F)F)CC2)nnc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H21Cl2F3N6O2/c19-13-3-1-2-12(14(13)20)15-16(24)25-17(27-26-15)29-6-4-28(5-7-29)8-11(30)9-31-10-18(21,22)23/h1-3,11,30H,4-10H2,(H2,24,25,27)/t11-/m0/s1 |
| InChIKey | PHYCVMDKPNZUKK-NSHDSACASA-N |
| XLogP | 2.49 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |