C18H24Cl2N4O4 — CID 147018459
4-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-1-[2-(2-methoxyethoxy)ethoxy]butan-2-ol (PubChem CID 147018459) has the molecular formula C18H24Cl2N4O4 and a molecular weight of 431.32 g/mol. Its IUPAC name is 4-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-1-[2-(2-methoxyethoxy)ethoxy]butan-2-ol.
| Compound Name | 4-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-1-[2-(2-methoxyethoxy)ethoxy]butan-2-ol |
|---|---|
| PubChem CID | 147018459 |
| Molecular Formula | C18H24Cl2N4O4 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-1-[2-(2-methoxyethoxy)ethoxy]butan-2-ol |
| SMILES | COCCOCCOCC(O)CCc1nnc(-c2cccc(Cl)c2Cl)c(N)n1 |
| InChI | InChI=1S/C18H24Cl2N4O4/c1-26-7-8-27-9-10-28-11-12(25)5-6-15-22-18(21)17(24-23-15)13-3-2-4-14(19)16(13)20/h2-4,12,25H,5-11H2,1H3,(H2,21,22,23) |
| InChIKey | AVFVOCYJNVIYLE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 112.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|