C23H35Cl2N5O8 — CID 73437652
cyclohexane-1,2,3,4,5,6-hexol;6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine;2-propylpentanoic acid (PubChem CID 73437652) has the molecular formula C23H35Cl2N5O8 and a molecular weight of 580.47 g/mol. Its IUPAC name is cyclohexane-1,2,3,4,5,6-hexol;6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine;2-propylpentanoic acid.
| Compound Name | cyclohexane-1,2,3,4,5,6-hexol;6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine;2-propylpentanoic acid |
|---|---|
| PubChem CID | 73437652 |
| Molecular Formula | C23H35Cl2N5O8 |
| Molecular Weight | 580.47 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | cyclohexane-1,2,3,4,5,6-hexol;6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine;2-propylpentanoic acid |
| SMILES | CCCC(CCC)C(=O)O.Nc1nnc(-c2cccc(Cl)c2Cl)c(N)n1.OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C9H7Cl2N5.C8H16O2.C6H12O6/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7;1-3-5-7(6-4-2)8(9)10;7-1-2(8)4(10)6(12)5(11)3(1)9/h1-3H,(H4,12,13,14,16);7H,3-6H2,1-2H3,(H,9,10);1-12H |
| InChIKey | PUIWGAVFILCLRW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 249.39 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.47 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |