C13H12BrCl2N5O2 — CID 175443022
2-[[6-amino-3-bromo-5-(2,3-dichlorophenyl)pyrazin-2-yl]amino]ethyl carbamate (PubChem CID 175443022) has the molecular formula C13H12BrCl2N5O2 and a molecular weight of 421.08 g/mol. Its IUPAC name is 2-[[6-amino-3-bromo-5-(2,3-dichlorophenyl)pyrazin-2-yl]amino]ethyl carbamate.
| Compound Name | 2-[[6-amino-3-bromo-5-(2,3-dichlorophenyl)pyrazin-2-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 175443022 |
| Molecular Formula | C13H12BrCl2N5O2 |
| Molecular Weight | 421.08 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 2-[[6-amino-3-bromo-5-(2,3-dichlorophenyl)pyrazin-2-yl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1nc(N)c(-c2cccc(Cl)c2Cl)nc1Br |
| InChI | InChI=1S/C13H12BrCl2N5O2/c14-10-12(19-4-5-23-13(18)22)21-11(17)9(20-10)6-2-1-3-7(15)8(6)16/h1-3H,4-5H2,(H2,18,22)(H3,17,19,21) |
| InChIKey | KERXIXCKMAFSBM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.08 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|