C17H22Cl2N6O4 — CID 126643299
N-[3-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]-2-hydroxypropyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 126643299) has the molecular formula C17H22Cl2N6O4 and a molecular weight of 445.31 g/mol. Its IUPAC name is N-[3-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]-2-hydroxypropyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[3-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]-2-hydroxypropyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 126643299 |
| Molecular Formula | C17H22Cl2N6O4 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[3-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]-2-hydroxypropyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NCC(O)CNc1nnc(-c2cccc(Cl)c2Cl)c(N)n1 |
| InChI | InChI=1S/C17H22Cl2N6O4/c1-28-5-6-29-9-13(27)21-7-10(26)8-22-17-23-16(20)15(24-25-17)11-3-2-4-12(18)14(11)19/h2-4,10,26H,5-9H2,1H3,(H,21,27)(H3,20,22,23,25) |
| InChIKey | BPRNQHNMRUYCPE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|