C15H20ClN5O4S — CID 144867790
2-[2-[[5-amino-6-(3-chloro-2-methylphenyl)-1,2,4-triazin-3-yl]amino]ethoxy]ethyl methanesulfonate (PubChem CID 144867790) has the molecular formula C15H20ClN5O4S and a molecular weight of 401.88 g/mol. Its IUPAC name is 2-[2-[[5-amino-6-(3-chloro-2-methylphenyl)-1,2,4-triazin-3-yl]amino]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[[5-amino-6-(3-chloro-2-methylphenyl)-1,2,4-triazin-3-yl]amino]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 144867790 |
| Molecular Formula | C15H20ClN5O4S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-[2-[[5-amino-6-(3-chloro-2-methylphenyl)-1,2,4-triazin-3-yl]amino]ethoxy]ethyl methanesulfonate |
| SMILES | Cc1c(Cl)cccc1-c1nnc(NCCOCCOS(C)(=O)=O)nc1N |
| InChI | InChI=1S/C15H20ClN5O4S/c1-10-11(4-3-5-12(10)16)13-14(17)19-15(21-20-13)18-6-7-24-8-9-25-26(2,22)23/h3-5H,6-9H2,1-2H3,(H3,17,18,19,21) |
| InChIKey | WGAOFRIIVCUNDM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|