C16H22ClN5O2 — CID 123949886
2-[2-[[5-amino-6-(2-chloro-3-methylphenyl)-1,2,4-triazin-3-yl]amino]-2-methylpropoxy]ethanol (PubChem CID 123949886) has the molecular formula C16H22ClN5O2 and a molecular weight of 351.84 g/mol. Its IUPAC name is 2-[2-[[5-amino-6-(2-chloro-3-methylphenyl)-1,2,4-triazin-3-yl]amino]-2-methylpropoxy]ethanol.
| Compound Name | 2-[2-[[5-amino-6-(2-chloro-3-methylphenyl)-1,2,4-triazin-3-yl]amino]-2-methylpropoxy]ethanol |
|---|---|
| PubChem CID | 123949886 |
| Molecular Formula | C16H22ClN5O2 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-[2-[[5-amino-6-(2-chloro-3-methylphenyl)-1,2,4-triazin-3-yl]amino]-2-methylpropoxy]ethanol |
| SMILES | Cc1cccc(-c2nnc(NC(C)(C)COCCO)nc2N)c1Cl |
| InChI | InChI=1S/C16H22ClN5O2/c1-10-5-4-6-11(12(10)17)13-14(18)19-15(22-21-13)20-16(2,3)9-24-8-7-23/h4-6,23H,7-9H2,1-3H3,(H3,18,19,20,22) |
| InChIKey | MNVBWEWGYROVGV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|