C13H14Cl2N4O — CID 158135296
6-(2,3-dichlorophenyl)-5-(3-methoxypropyl)-1,2,4-triazin-3-amine (PubChem CID 158135296) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is 6-(2,3-dichlorophenyl)-5-(3-methoxypropyl)-1,2,4-triazin-3-amine.
| Compound Name | 6-(2,3-dichlorophenyl)-5-(3-methoxypropyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 158135296 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 6-(2,3-dichlorophenyl)-5-(3-methoxypropyl)-1,2,4-triazin-3-amine |
| SMILES | COCCCc1nc(N)nnc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl2N4O/c1-20-7-3-6-10-12(18-19-13(16)17-10)8-4-2-5-9(14)11(8)15/h2,4-5H,3,6-7H2,1H3,(H2,16,17,19) |
| InChIKey | SHDQAYVQNAJSGY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|