C12H12Cl2N4 — CID 19705124
5-(2,3-dichlorophenyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine (PubChem CID 19705124) has the molecular formula C12H12Cl2N4 and a molecular weight of 283.16 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine.
| Compound Name | 5-(2,3-dichlorophenyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 19705124 |
| Molecular Formula | C12H12Cl2N4 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1nc(N)ncc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl2N4/c1-18(2)11-8(6-16-12(15)17-11)7-4-3-5-9(13)10(7)14/h3-6H,1-2H3,(H2,15,16,17) |
| InChIKey | VKEFWPIXDZWNCI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |