C31H33FN3O6S2+ — CID 118167607
1-acetyl-2-cyclopropyl-1-(4-fluorophenyl)sulfonyl-N-(3-methylsulfonylphenyl)spiro[2H-indol-1-ium-3,4'-piperidine]-5-carboxamide (PubChem CID 118167607) has the molecular formula C31H33FN3O6S2+ and a molecular weight of 626.75 g/mol. Its IUPAC name is 1-acetyl-2-cyclopropyl-1-(4-fluorophenyl)sulfonyl-N-(3-methylsulfonylphenyl)spiro[2H-indol-1-ium-3,4'-piperidine]-5-carboxamide.
| Compound Name | 1-acetyl-2-cyclopropyl-1-(4-fluorophenyl)sulfonyl-N-(3-methylsulfonylphenyl)spiro[2H-indol-1-ium-3,4'-piperidine]-5-carboxamide |
|---|---|
| PubChem CID | 118167607 |
| Molecular Formula | C31H33FN3O6S2+ |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | 1-acetyl-2-cyclopropyl-1-(4-fluorophenyl)sulfonyl-N-(3-methylsulfonylphenyl)spiro[2H-indol-1-ium-3,4'-piperidine]-5-carboxamide |
| SMILES | CC(=O)[N+]1(S(=O)(=O)c2ccc(F)cc2)c2ccc(C(=O)Nc3cccc(S(C)(=O)=O)c3)cc2C2(CCNCC2)C1C1CC1 |
| InChI | InChI=1S/C31H32FN3O6S2/c1-20(36)35(43(40,41)25-11-9-23(32)10-12-25)28-13-8-22(30(37)34-24-4-3-5-26(19-24)42(2,38)39)18-27(28)31(14-16-33-17-15-31)29(35)21-6-7-21/h3-5,8-13,18-19,21,29,33H,6-7,14-17H2,1-2H3/p+1 |
| InChIKey | VUBMOLSALUNSAR-UHFFFAOYSA-O |
| XLogP | 4.14 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|