C29H35F3N4O5S — CID 118169837
ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoate (PubChem CID 118169837) has the molecular formula C29H35F3N4O5S and a molecular weight of 608.68 g/mol. Its IUPAC name is ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoate.
| Compound Name | ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 118169837 |
| Molecular Formula | C29H35F3N4O5S |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoate |
| SMILES | CCOC(=O)CC(CCc1cn(CC)nn1)c1ccc(C(F)(F)F)c(CN2C[C@@H](CC)Oc3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C29H35F3N4O5S/c1-4-24-19-36(42(38,39)27-10-8-7-9-26(27)41-24)17-22-15-20(12-14-25(22)29(30,31)32)21(16-28(37)40-6-3)11-13-23-18-35(5-2)34-33-23/h7-10,12,14-15,18,21,24H,4-6,11,13,16-17,19H2,1-3H3/t21?,24-/m1/s1 |
| InChIKey | HCPZBAVVKOXNHI-MQNHUJCZSA-N |
| XLogP | 5.35 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |