C17H20F3N3O3 — CID 118170621
5-(1-ethyltriazol-4-yl)-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 118170621) has the molecular formula C17H20F3N3O3 and a molecular weight of 371.36 g/mol. Its IUPAC name is 5-(1-ethyltriazol-4-yl)-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 5-(1-ethyltriazol-4-yl)-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 118170621 |
| Molecular Formula | C17H20F3N3O3 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 5-(1-ethyltriazol-4-yl)-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | CCn1cc(CCC(CC(=O)O)c2ccc(C(F)(F)F)c(CO)c2)nn1 |
| InChI | InChI=1S/C17H20F3N3O3/c1-2-23-9-14(21-22-23)5-3-12(8-16(25)26)11-4-6-15(17(18,19)20)13(7-11)10-24/h4,6-7,9,12,24H,2-3,5,8,10H2,1H3,(H,25,26) |
| InChIKey | RHOODEKSLKYUOU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |