C19H24F3N3O3 — CID 118170330
ethyl 5-(1-ethyltriazol-4-yl)-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]pentanoate (PubChem CID 118170330) has the molecular formula C19H24F3N3O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is ethyl 5-(1-ethyltriazol-4-yl)-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]pentanoate.
| Compound Name | ethyl 5-(1-ethyltriazol-4-yl)-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]pentanoate |
|---|---|
| PubChem CID | 118170330 |
| Molecular Formula | C19H24F3N3O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethyl 5-(1-ethyltriazol-4-yl)-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]pentanoate |
| SMILES | CCOC(=O)CC(CCc1cn(CC)nn1)c1ccc(C(F)(F)F)c(CO)c1 |
| InChI | InChI=1S/C19H24F3N3O3/c1-3-25-11-16(23-24-25)7-5-14(10-18(27)28-4-2)13-6-8-17(19(20,21)22)15(9-13)12-26/h6,8-9,11,14,26H,3-5,7,10,12H2,1-2H3 |
| InChIKey | YSQDZQQALBRRTH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |