C19H26FN3O3 — CID 122662538
ethyl 5-(1-ethyltriazol-4-yl)-3-[4-(fluoromethyl)-3-(hydroxymethyl)phenyl]pentanoate (PubChem CID 122662538) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is ethyl 5-(1-ethyltriazol-4-yl)-3-[4-(fluoromethyl)-3-(hydroxymethyl)phenyl]pentanoate.
| Compound Name | ethyl 5-(1-ethyltriazol-4-yl)-3-[4-(fluoromethyl)-3-(hydroxymethyl)phenyl]pentanoate |
|---|---|
| PubChem CID | 122662538 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | ethyl 5-(1-ethyltriazol-4-yl)-3-[4-(fluoromethyl)-3-(hydroxymethyl)phenyl]pentanoate |
| SMILES | CCOC(=O)CC(CCc1cn(CC)nn1)c1ccc(CF)c(CO)c1 |
| InChI | InChI=1S/C19H26FN3O3/c1-3-23-12-18(21-22-23)8-7-15(10-19(25)26-4-2)14-5-6-16(11-20)17(9-14)13-24/h5-6,9,12,15,24H,3-4,7-8,10-11,13H2,1-2H3 |
| InChIKey | BYQIJPZIBAQCJF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |