C13H12F3N3O3 — CID 167772310
3-[4-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]triazol-1-yl]propanoic acid (PubChem CID 167772310) has the molecular formula C13H12F3N3O3 and a molecular weight of 315.25 g/mol. Its IUPAC name is 3-[4-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]triazol-1-yl]propanoic acid.
| Compound Name | 3-[4-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]triazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 167772310 |
| Molecular Formula | C13H12F3N3O3 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-[4-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]triazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(C(O)c2cccc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C13H12F3N3O3/c14-13(15,16)9-3-1-2-8(6-9)12(22)10-7-19(18-17-10)5-4-11(20)21/h1-3,6-7,12,22H,4-5H2,(H,20,21) |
| InChIKey | CGXRNJGOLJSRFL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |