C23H32N4O5 — CID 16758514
methyl (Z,5R,6S,7Z)-7-[(1S)-1-[1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]triazol-4-yl]ethoxy]imino-6-methoxy-5-methylhept-3-enoate (PubChem CID 16758514) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is methyl (Z,5R,6S,7Z)-7-[(1S)-1-[1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]triazol-4-yl]ethoxy]imino-6-methoxy-5-methylhept-3-enoate.
| Compound Name | methyl (Z,5R,6S,7Z)-7-[(1S)-1-[1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]triazol-4-yl]ethoxy]imino-6-methoxy-5-methylhept-3-enoate |
|---|---|
| PubChem CID | 16758514 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | methyl (Z,5R,6S,7Z)-7-[(1S)-1-[1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]triazol-4-yl]ethoxy]imino-6-methoxy-5-methylhept-3-enoate |
| SMILES | COC(=O)C/C=C\[C@@H](C)[C@@H](/C=N\O[C@@H](C)c1cn([C@H](CO)Cc2ccccc2)nn1)OC |
| InChI | InChI=1S/C23H32N4O5/c1-17(9-8-12-23(29)31-4)22(30-3)14-24-32-18(2)21-15-27(26-25-21)20(16-28)13-19-10-6-5-7-11-19/h5-11,14-15,17-18,20,22,28H,12-13,16H2,1-4H3/b9-8-,24-14-/t17-,18+,20+,22-/m1/s1 |
| InChIKey | KPYSXVDPYCPICV-PMXMSFGQSA-N |
| XLogP | 2.89 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|