C11H9F3N4S — CID 118171813
5-[[4-amino-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophene-2-carbonitrile (PubChem CID 118171813) has the molecular formula C11H9F3N4S and a molecular weight of 286.28 g/mol. Its IUPAC name is 5-[[4-amino-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[[4-amino-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 118171813 |
| Molecular Formula | C11H9F3N4S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-[[4-amino-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophene-2-carbonitrile |
| SMILES | Cc1c(N)c(C(F)(F)F)nn1Cc1ccc(C#N)s1 |
| InChI | InChI=1S/C11H9F3N4S/c1-6-9(16)10(11(12,13)14)17-18(6)5-8-3-2-7(4-15)19-8/h2-3H,5,16H2,1H3 |
| InChIKey | RZRKIVMGRUGOPL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |