C14H9F3N6S — CID 2821099
(Z)-2-amino-3-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methylideneamino]but-2-enedinitrile (PubChem CID 2821099) has the molecular formula C14H9F3N6S and a molecular weight of 350.33 g/mol. Its IUPAC name is (Z)-2-amino-3-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methylideneamino]but-2-enedinitrile.
| Compound Name | (Z)-2-amino-3-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 2821099 |
| Molecular Formula | C14H9F3N6S |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (Z)-2-amino-3-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methylideneamino]but-2-enedinitrile |
| SMILES | Cn1nc(-c2ccc(/C=N/C(C#N)=C(\N)C#N)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H9F3N6S/c1-23-13(14(15,16)17)4-10(22-23)12-3-2-8(24-12)7-21-11(6-19)9(20)5-18/h2-4,7H,20H2,1H3/b11-9-,21-7+ |
| InChIKey | FNTMVLAIDKSULA-SIMPAMIASA-N |
| XLogP | 2.80 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|