C16H11ClF3N3S — CID 2821134
N-(4-chlorophenyl)-1-[5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]methanimine (PubChem CID 2821134) has the molecular formula C16H11ClF3N3S and a molecular weight of 369.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-[5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]methanimine.
| Compound Name | N-(4-chlorophenyl)-1-[5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]methanimine |
|---|---|
| PubChem CID | 2821134 |
| Molecular Formula | C16H11ClF3N3S |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-(4-chlorophenyl)-1-[5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]methanimine |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccc(/C=N/c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C16H11ClF3N3S/c1-23-13(8-15(22-23)16(18,19)20)14-7-6-12(24-14)9-21-11-4-2-10(17)3-5-11/h2-9H,1H3/b21-9+ |
| InChIKey | DPBCVSSAKDJHDG-ZVBGSRNCSA-N |
| XLogP | 5.57 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|