C15H10ClF3N2S2 — CID 2820854
3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-1-methyl-5-(trifluoromethyl)pyrazole (PubChem CID 2820854) has the molecular formula C15H10ClF3N2S2 and a molecular weight of 374.84 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-1-methyl-5-(trifluoromethyl)pyrazole.
| Compound Name | 3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-1-methyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 2820854 |
| Molecular Formula | C15H10ClF3N2S2 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-1-methyl-5-(trifluoromethyl)pyrazole |
| SMILES | Cn1nc(-c2ccc(Sc3ccc(Cl)cc3)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H10ClF3N2S2/c1-21-13(15(17,18)19)8-11(20-21)12-6-7-14(23-12)22-10-4-2-9(16)3-5-10/h2-8H,1H3 |
| InChIKey | GVHJNXGIGRJJEJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |