C16H12ClN3O4 — CID 118173050
6-chloro-5-(phenylmethoxycarbonylamino)indazole-2-carboxylic acid (PubChem CID 118173050) has the molecular formula C16H12ClN3O4 and a molecular weight of 345.74 g/mol. Its IUPAC name is 6-chloro-5-(phenylmethoxycarbonylamino)indazole-2-carboxylic acid.
| Compound Name | 6-chloro-5-(phenylmethoxycarbonylamino)indazole-2-carboxylic acid |
|---|---|
| PubChem CID | 118173050 |
| Molecular Formula | C16H12ClN3O4 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 6-chloro-5-(phenylmethoxycarbonylamino)indazole-2-carboxylic acid |
| SMILES | O=C(Nc1cc2cn(C(=O)O)nc2cc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C16H12ClN3O4/c17-12-7-13-11(8-20(19-13)16(22)23)6-14(12)18-15(21)24-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,18,21)(H,22,23) |
| InChIKey | QUZSYLSPQRIRCR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |