C14H16O2Si — CID 11817411
(5Z)-5-[(2E,6E)-7-trimethylsilylhepta-2,6-dien-4-ynylidene]furan-2-one (PubChem CID 11817411) has the molecular formula C14H16O2Si and a molecular weight of 244.37 g/mol. Its IUPAC name is (5Z)-5-[(2E,6E)-7-trimethylsilylhepta-2,6-dien-4-ynylidene]furan-2-one.
| Compound Name | (5Z)-5-[(2E,6E)-7-trimethylsilylhepta-2,6-dien-4-ynylidene]furan-2-one |
|---|---|
| PubChem CID | 11817411 |
| Molecular Formula | C14H16O2Si |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (5Z)-5-[(2E,6E)-7-trimethylsilylhepta-2,6-dien-4-ynylidene]furan-2-one |
| SMILES | C[Si](C)(C)/C=C/C#C/C=C/C=C1/C=CC(=O)O1 |
| InChI | InChI=1S/C14H16O2Si/c1-17(2,3)12-8-6-4-5-7-9-13-10-11-14(15)16-13/h5,7-12H,1-3H3/b7-5+,12-8+,13-9- |
| InChIKey | QKWIBYYCNDFHMK-ADYOKBENSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|